C19H32N2O4 — CID 981369
(4S,5S)-4-N,5-N-dicyclohexyl-2,2-dimethyl-1,3-dioxolane-4,5-dicarboxamide (PubChem CID 981369) has the molecular formula C19H32N2O4 and a molecular weight of 352.48 g/mol. Its IUPAC name is (4S,5S)-4-N,5-N-dicyclohexyl-2,2-dimethyl-1,3-dioxolane-4,5-dicarboxamide.
| Compound Name | (4S,5S)-4-N,5-N-dicyclohexyl-2,2-dimethyl-1,3-dioxolane-4,5-dicarboxamide |
|---|---|
| PubChem CID | 981369 |
| Molecular Formula | C19H32N2O4 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.24 |
| IUPAC Name | (4S,5S)-4-N,5-N-dicyclohexyl-2,2-dimethyl-1,3-dioxolane-4,5-dicarboxamide |
| SMILES | CC1(C)O[C@H](C(=O)NC2CCCCC2)[C@@H](C(=O)NC2CCCCC2)O1 |
| InChI | InChI=1S/C19H32N2O4/c1-19(2)24-15(17(22)20-13-9-5-3-6-10-13)16(25-19)18(23)21-14-11-7-4-8-12-14/h13-16H,3-12H2,1-2H3,(H,20,22)(H,21,23)/t15-,16-/m0/s1 |
| InChIKey | YGCRKAQQHPNVDW-HOTGVXAUSA-N |
| XLogP | 2.40 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |