C13H22N4O5 — CID 174076598
[(2S,5R)-5-[[acetyl-[(Z)-3-amino-3-hydroxyiminoprop-1-enyl]amino]methyl]oxolan-2-yl]methyl N-methylcarbamate (PubChem CID 174076598) has the molecular formula C13H22N4O5 and a molecular weight of 314.34 g/mol. Its IUPAC name is [(2S,5R)-5-[[acetyl-[(Z)-3-amino-3-hydroxyiminoprop-1-enyl]amino]methyl]oxolan-2-yl]methyl N-methylcarbamate.
| Compound Name | [(2S,5R)-5-[[acetyl-[(Z)-3-amino-3-hydroxyiminoprop-1-enyl]amino]methyl]oxolan-2-yl]methyl N-methylcarbamate |
|---|---|
| PubChem CID | 174076598 |
| Molecular Formula | C13H22N4O5 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | [(2S,5R)-5-[[acetyl-[(Z)-3-amino-3-hydroxyiminoprop-1-enyl]amino]methyl]oxolan-2-yl]methyl N-methylcarbamate |
| SMILES | CNC(=O)OC[C@@H]1CC[C@H](CN(/C=C\C(N)=NO)C(C)=O)O1 |
| InChI | InChI=1S/C13H22N4O5/c1-9(18)17(6-5-12(14)16-20)7-10-3-4-11(22-10)8-21-13(19)15-2/h5-6,10-11,20H,3-4,7-8H2,1-2H3,(H2,14,16)(H,15,19)/b6-5-/t10-,11+/m1/s1 |
| InChIKey | QNRYADYAVLQFBG-MXFLAHGMSA-N |
| XLogP | -0.00 |
| TPSA | 126.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|