C10H14O5 — CID 175935617
3-[5-(acetyloxymethyl)oxolan-2-yl]prop-2-enoic acid (PubChem CID 175935617) has the molecular formula C10H14O5 and a molecular weight of 214.22 g/mol. Its IUPAC name is 3-[5-(acetyloxymethyl)oxolan-2-yl]prop-2-enoic acid.
| Compound Name | 3-[5-(acetyloxymethyl)oxolan-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 175935617 |
| Molecular Formula | C10H14O5 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | 3-[5-(acetyloxymethyl)oxolan-2-yl]prop-2-enoic acid |
| SMILES | CC(=O)OCC1CCC(C=CC(=O)O)O1 |
| InChI | InChI=1S/C10H14O5/c1-7(11)14-6-9-3-2-8(15-9)4-5-10(12)13/h4-5,8-9H,2-3,6H2,1H3,(H,12,13) |
| InChIKey | UYSPAXMKUTWHQF-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|