About (5-formylfuran-2-yl)methyl acetate;[5-(hydroxymethyl)oxolan-2-yl]methyl acetate;molecular hydrogen
(5-formylfuran-2-yl)methyl acetate;[5-(hydroxymethyl)oxolan-2-yl]methyl acetate;molecular hydrogen (PubChem CID 158130539) has the molecular formula C16H24O8
and a molecular weight of 344.36 g/mol. Its IUPAC name is (5-formylfuran-2-yl)methyl acetate;[5-(hydroxymethyl)oxolan-2-yl]methyl acetate;molecular hydrogen.
Molecular Properties
| Compound Name | (5-formylfuran-2-yl)methyl acetate;[5-(hydroxymethyl)oxolan-2-yl]methyl acetate;molecular hydrogen |
| PubChem CID | 158130539 |
| Molecular Formula | C16H24O8 |
| Molecular Weight | 344.36 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | (5-formylfuran-2-yl)methyl acetate;[5-(hydroxymethyl)oxolan-2-yl]methyl acetate;molecular hydrogen |
| SMILES | CC(=O)OCC1CCC(CO)O1.CC(=O)OCc1ccc(C=O)o1.[H][H] |
| InChI | InChI=1S/C8H14O4.C8H8O4.H2/c2*1-6(10)11-5-8-3-2-7(4-9)12-8;/h7-9H,2-5H2,1H3;2-4H,5H2,1H3;1H |
| InChIKey | FSSJWSWMFJHVJK-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 112.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.36 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (5-formylfuran-2-yl)methyl acetate;[5-(hydroxymethyl)oxolan-2-yl]methyl acetate;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-formylfuran-2-yl)methyl acetate;[5-(hydroxymethyl)oxolan-2-yl]methyl acetate;molecular hydrogen?
The IUPAC name of (5-formylfuran-2-yl)methyl acetate;[5-(hydroxymethyl)oxolan-2-yl]methyl acetate;molecular hydrogen (CID 158130539) is (5-formylfuran-2-yl)methyl acetate;[5-(hydroxymethyl)oxolan-2-yl]methyl acetate;molecular hydrogen.
What is the SMILES notation for (5-formylfuran-2-yl)methyl acetate;[5-(hydroxymethyl)oxolan-2-yl]methyl acetate;molecular hydrogen?
The canonical SMILES for (5-formylfuran-2-yl)methyl acetate;[5-(hydroxymethyl)oxolan-2-yl]methyl acetate;molecular hydrogen is CC(=O)OCC1CCC(CO)O1.CC(=O)OCc1ccc(C=O)o1.[H][H].
What is the InChIKey of (5-formylfuran-2-yl)methyl acetate;[5-(hydroxymethyl)oxolan-2-yl]methyl acetate;molecular hydrogen?
The InChIKey is FSSJWSWMFJHVJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O4.C8H8O4.H2/c2*1-6(10)11-5-8-3-2-7(4-9)12-8;/h7-9H,2-5H2,1H3;2-4H,5H2,1H3;1H.
What are the key properties of (5-formylfuran-2-yl)methyl acetate;[5-(hydroxymethyl)oxolan-2-yl]methyl acetate;molecular hydrogen?
(5-formylfuran-2-yl)methyl acetate;[5-(hydroxymethyl)oxolan-2-yl]methyl acetate;molecular hydrogen has a molecular weight of 344.36 g/mol, XLogP of 1.49, 6 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (5-formylfuran-2-yl)methyl acetate;[5-(hydroxymethyl)oxolan-2-yl]methyl acetate;molecular hydrogen is sourced from PubChem (CID 158130539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).