C12H18O5 — CID 145448996
(5-formylfuran-2-yl)methyl 2-methylbutan-2-yl carbonate;molecular hydrogen (PubChem CID 145448996) has the molecular formula C12H18O5 and a molecular weight of 242.27 g/mol. Its IUPAC name is (5-formylfuran-2-yl)methyl 2-methylbutan-2-yl carbonate;molecular hydrogen.
| Compound Name | (5-formylfuran-2-yl)methyl 2-methylbutan-2-yl carbonate;molecular hydrogen |
|---|---|
| PubChem CID | 145448996 |
| Molecular Formula | C12H18O5 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | (5-formylfuran-2-yl)methyl 2-methylbutan-2-yl carbonate;molecular hydrogen |
| SMILES | CCC(C)(C)OC(=O)OCc1ccc(C=O)o1.[H][H] |
| InChI | InChI=1S/C12H16O5.H2/c1-4-12(2,3)17-11(14)15-8-10-6-5-9(7-13)16-10;/h5-7H,4,8H2,1-3H3;1H |
| InChIKey | WUWKPHNLCLGWGD-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|