C14H23NO4 — CID 139435281
5-[[2-amino-4-[(2-methylpropan-2-yl)oxy]butan-2-yl]oxymethyl]furan-2-carbaldehyde (PubChem CID 139435281) has the molecular formula C14H23NO4 and a molecular weight of 269.34 g/mol. Its IUPAC name is 5-[[2-amino-4-[(2-methylpropan-2-yl)oxy]butan-2-yl]oxymethyl]furan-2-carbaldehyde.
| Compound Name | 5-[[2-amino-4-[(2-methylpropan-2-yl)oxy]butan-2-yl]oxymethyl]furan-2-carbaldehyde |
|---|---|
| PubChem CID | 139435281 |
| Molecular Formula | C14H23NO4 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | 5-[[2-amino-4-[(2-methylpropan-2-yl)oxy]butan-2-yl]oxymethyl]furan-2-carbaldehyde |
| SMILES | CC(C)(C)OCCC(C)(N)OCc1ccc(C=O)o1 |
| InChI | InChI=1S/C14H23NO4/c1-13(2,3)17-8-7-14(4,15)18-10-12-6-5-11(9-16)19-12/h5-6,9H,7-8,10,15H2,1-4H3 |
| InChIKey | VKCTWIJTLWKXPU-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|