C6H5NaO6S — CID 71752262
sodium [5-(oxo(113C)methyl)(2,3,4,5-13C4)furan-2-yl](113C)methyl sulfate (PubChem CID 71752262) has the molecular formula C6H5NaO6S and a molecular weight of 234.11 g/mol. Its IUPAC name is sodium [5-(oxo(113C)methyl)(2,3,4,5-13C4)furan-2-yl](113C)methyl sulfate.
| Compound Name | sodium [5-(oxo(113C)methyl)(2,3,4,5-13C4)furan-2-yl](113C)methyl sulfate |
|---|---|
| PubChem CID | 71752262 |
| Molecular Formula | C6H5NaO6S |
| Molecular Weight | 234.11 g/mol |
| Exact Mass | 233.99 |
| IUPAC Name | sodium [5-(oxo(113C)methyl)(2,3,4,5-13C4)furan-2-yl](113C)methyl sulfate |
| SMILES | O=[13CH][13c]1[13cH][13cH][13c]([13CH2]OS(=O)(=O)[O-])o1.[Na+] |
| InChI | InChI=1S/C6H6O6S.Na/c7-3-5-1-2-6(12-5)4-11-13(8,9)10;/h1-3H,4H2,(H,8,9,10);/q;+1/p-1/i1+1,2+1,3+1,4+1,5+1,6+1; |
| InChIKey | KTRGQDPJPVHDGB-BVNCJLROSA-M |
| XLogP | -2.93 |
| TPSA | 96.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.11 |
| LogP ≤ 5 | -2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|