About 5-(chloromethyl)furan-2-carbaldehyde;(5-formylfuran-2-yl)methyl acetate
5-(chloromethyl)furan-2-carbaldehyde;(5-formylfuran-2-yl)methyl acetate (PubChem CID 175563077) has the molecular formula C14H13ClO6
and a molecular weight of 312.71 g/mol. Its IUPAC name is 5-(chloromethyl)furan-2-carbaldehyde;(5-formylfuran-2-yl)methyl acetate.
Molecular Properties
| Compound Name | 5-(chloromethyl)furan-2-carbaldehyde;(5-formylfuran-2-yl)methyl acetate |
| PubChem CID | 175563077 |
| Molecular Formula | C14H13ClO6 |
| Molecular Weight | 312.71 g/mol |
| Exact Mass | 312.04 |
| IUPAC Name | 5-(chloromethyl)furan-2-carbaldehyde;(5-formylfuran-2-yl)methyl acetate |
| SMILES | CC(=O)OCc1ccc(C=O)o1.O=Cc1ccc(CCl)o1 |
| InChI | InChI=1S/C8H8O4.C6H5ClO2/c1-6(10)11-5-8-3-2-7(4-9)12-8;7-3-5-1-2-6(4-8)9-5/h2-4H,5H2,1H3;1-2,4H,3H2 |
| InChIKey | SSQUXQXVXDXJCS-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 86.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.71 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-(chloromethyl)furan-2-carbaldehyde;(5-formylfuran-2-yl)methyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(chloromethyl)furan-2-carbaldehyde;(5-formylfuran-2-yl)methyl acetate?
The IUPAC name of 5-(chloromethyl)furan-2-carbaldehyde;(5-formylfuran-2-yl)methyl acetate (CID 175563077) is 5-(chloromethyl)furan-2-carbaldehyde;(5-formylfuran-2-yl)methyl acetate.
What is the SMILES notation for 5-(chloromethyl)furan-2-carbaldehyde;(5-formylfuran-2-yl)methyl acetate?
The canonical SMILES for 5-(chloromethyl)furan-2-carbaldehyde;(5-formylfuran-2-yl)methyl acetate is CC(=O)OCc1ccc(C=O)o1.O=Cc1ccc(CCl)o1.
What is the InChIKey of 5-(chloromethyl)furan-2-carbaldehyde;(5-formylfuran-2-yl)methyl acetate?
The InChIKey is SSQUXQXVXDXJCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O4.C6H5ClO2/c1-6(10)11-5-8-3-2-7(4-9)12-8;7-3-5-1-2-6(4-8)9-5/h2-4H,5H2,1H3;1-2,4H,3H2.
What are the key properties of 5-(chloromethyl)furan-2-carbaldehyde;(5-formylfuran-2-yl)methyl acetate?
5-(chloromethyl)furan-2-carbaldehyde;(5-formylfuran-2-yl)methyl acetate has a molecular weight of 312.71 g/mol, XLogP of 2.99, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(chloromethyl)furan-2-carbaldehyde;(5-formylfuran-2-yl)methyl acetate is sourced from PubChem (CID 175563077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).