C19H31N3O6 — CID 174077007
[(2S,5R)-5-[(Z)-7-amino-4-methyl-7-(methylcarbamoyloxyimino)-2-oxohept-5-en-3-yl]oxolan-2-yl]methyl 2-methylpropanoate (PubChem CID 174077007) has the molecular formula C19H31N3O6 and a molecular weight of 397.47 g/mol. Its IUPAC name is [(2S,5R)-5-[(Z)-7-amino-4-methyl-7-(methylcarbamoyloxyimino)-2-oxohept-5-en-3-yl]oxolan-2-yl]methyl 2-methylpropanoate.
| Compound Name | [(2S,5R)-5-[(Z)-7-amino-4-methyl-7-(methylcarbamoyloxyimino)-2-oxohept-5-en-3-yl]oxolan-2-yl]methyl 2-methylpropanoate |
|---|---|
| PubChem CID | 174077007 |
| Molecular Formula | C19H31N3O6 |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.22 |
| IUPAC Name | [(2S,5R)-5-[(Z)-7-amino-4-methyl-7-(methylcarbamoyloxyimino)-2-oxohept-5-en-3-yl]oxolan-2-yl]methyl 2-methylpropanoate |
| SMILES | CNC(=O)ON=C(N)/C=C\C(C)C(C(C)=O)[C@H]1CC[C@@H](COC(=O)C(C)C)O1 |
| InChI | InChI=1S/C19H31N3O6/c1-11(2)18(24)26-10-14-7-8-15(27-14)17(13(4)23)12(3)6-9-16(20)22-28-19(25)21-5/h6,9,11-12,14-15,17H,7-8,10H2,1-5H3,(H2,20,22)(H,21,25)/b9-6-/t12?,14-,15+,17?/m0/s1 |
| InChIKey | OKOGYYDBHSAYKZ-LOGNCTTDSA-N |
| XLogP | 1.76 |
| TPSA | 129.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|