C11H20O4 — CID 101161874
methyl 2-[5-(2-hydroxy(113C)propyl)(513C)oxolan-2-yl]propanoate (PubChem CID 101161874) has the molecular formula C11H20O4 and a molecular weight of 218.26 g/mol. Its IUPAC name is methyl 2-[5-(2-hydroxy(113C)propyl)(513C)oxolan-2-yl]propanoate.
| Compound Name | methyl 2-[5-(2-hydroxy(113C)propyl)(513C)oxolan-2-yl]propanoate |
|---|---|
| PubChem CID | 101161874 |
| Molecular Formula | C11H20O4 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | methyl 2-[5-(2-hydroxy(113C)propyl)(513C)oxolan-2-yl]propanoate |
| SMILES | COC(=O)C(C)C1CC[13CH]([13CH2]C(C)O)O1 |
| InChI | InChI=1S/C11H20O4/c1-7(12)6-9-4-5-10(15-9)8(2)11(13)14-3/h7-10,12H,4-6H2,1-3H3/i6+1,9+1 |
| InChIKey | CEDXFNKFNJLPRR-LLJQJJQBSA-N |
| XLogP | 1.11 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |