C20H38O3Si — CID 11337192
1-[(2R,5R)-5-[(1R,2E)-5-methyl-1-triethylsilyloxyhexa-2,4-dienyl]oxolan-2-yl]propan-2-ol (PubChem CID 11337192) has the molecular formula C20H38O3Si and a molecular weight of 354.61 g/mol. Its IUPAC name is 1-[(2R,5R)-5-[(1R,2E)-5-methyl-1-triethylsilyloxyhexa-2,4-dienyl]oxolan-2-yl]propan-2-ol.
| Compound Name | 1-[(2R,5R)-5-[(1R,2E)-5-methyl-1-triethylsilyloxyhexa-2,4-dienyl]oxolan-2-yl]propan-2-ol |
|---|---|
| PubChem CID | 11337192 |
| Molecular Formula | C20H38O3Si |
| Molecular Weight | 354.61 g/mol |
| Exact Mass | 354.26 |
| IUPAC Name | 1-[(2R,5R)-5-[(1R,2E)-5-methyl-1-triethylsilyloxyhexa-2,4-dienyl]oxolan-2-yl]propan-2-ol |
| SMILES | CC[Si](CC)(CC)O[C@H](/C=C/C=C(C)C)[C@H]1CC[C@H](CC(C)O)O1 |
| InChI | InChI=1S/C20H38O3Si/c1-7-24(8-2,9-3)23-20(12-10-11-16(4)5)19-14-13-18(22-19)15-17(6)21/h10-12,17-21H,7-9,13-15H2,1-6H3/b12-10+/t17?,18-,19-,20-/m1/s1 |
| InChIKey | UNYZRYKLJKQZEI-UAVSDSFZSA-N |
| XLogP | 5.22 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.61 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|