C16H27N3O5 — CID 163457397
[(2S,5R)-5-[[acetyl-[N-(1-aminoethenyl)-C-methylcarbonimidoyl]amino]methyl]oxolan-2-yl]methyl propan-2-yl carbonate (PubChem CID 163457397) has the molecular formula C16H27N3O5 and a molecular weight of 341.41 g/mol. Its IUPAC name is [(2S,5R)-5-[[acetyl-[N-(1-aminoethenyl)-C-methylcarbonimidoyl]amino]methyl]oxolan-2-yl]methyl propan-2-yl carbonate.
| Compound Name | [(2S,5R)-5-[[acetyl-[N-(1-aminoethenyl)-C-methylcarbonimidoyl]amino]methyl]oxolan-2-yl]methyl propan-2-yl carbonate |
|---|---|
| PubChem CID | 163457397 |
| Molecular Formula | C16H27N3O5 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | [(2S,5R)-5-[[acetyl-[N-(1-aminoethenyl)-C-methylcarbonimidoyl]amino]methyl]oxolan-2-yl]methyl propan-2-yl carbonate |
| SMILES | C=C(N)N=C(C)N(C[C@H]1CC[C@@H](COC(=O)OC(C)C)O1)C(C)=O |
| InChI | InChI=1S/C16H27N3O5/c1-10(2)23-16(21)22-9-15-7-6-14(24-15)8-19(13(5)20)12(4)18-11(3)17/h10,14-15H,3,6-9,17H2,1-2,4-5H3/t14-,15+/m1/s1 |
| InChIKey | BLQFUOBBWAMHIH-CABCVRRESA-N |
| XLogP | 1.79 |
| TPSA | 103.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|