C16H20FNO3 — CID 23931327
[2-[cyclohexyl(methyl)amino]-2-oxoethyl] 2-fluorobenzoate (PubChem CID 23931327) has the molecular formula C16H20FNO3 and a molecular weight of 293.34 g/mol. Its IUPAC name is [2-[cyclohexyl(methyl)amino]-2-oxoethyl] 2-fluorobenzoate.
| Compound Name | [2-[cyclohexyl(methyl)amino]-2-oxoethyl] 2-fluorobenzoate |
|---|---|
| PubChem CID | 23931327 |
| Molecular Formula | C16H20FNO3 |
| Molecular Weight | 293.34 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | [2-[cyclohexyl(methyl)amino]-2-oxoethyl] 2-fluorobenzoate |
| SMILES | CN(C(=O)COC(=O)c1ccccc1F)C1CCCCC1 |
| InChI | InChI=1S/C16H20FNO3/c1-18(12-7-3-2-4-8-12)15(19)11-21-16(20)13-9-5-6-10-14(13)17/h5-6,9-10,12H,2-4,7-8,11H2,1H3 |
| InChIKey | NQTKUSCBNAODLO-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.34 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |