C16H20INO3 — CID 71823696
[2-[cyclohexyl(methyl)amino]-2-oxoethyl] 2-iodobenzoate (PubChem CID 71823696) has the molecular formula C16H20INO3 and a molecular weight of 401.24 g/mol. Its IUPAC name is [2-[cyclohexyl(methyl)amino]-2-oxoethyl] 2-iodobenzoate.
| Compound Name | [2-[cyclohexyl(methyl)amino]-2-oxoethyl] 2-iodobenzoate |
|---|---|
| PubChem CID | 71823696 |
| Molecular Formula | C16H20INO3 |
| Molecular Weight | 401.24 g/mol |
| Exact Mass | 401.05 |
| IUPAC Name | [2-[cyclohexyl(methyl)amino]-2-oxoethyl] 2-iodobenzoate |
| SMILES | CN(C(=O)COC(=O)c1ccccc1I)C1CCCCC1 |
| InChI | InChI=1S/C16H20INO3/c1-18(12-7-3-2-4-8-12)15(19)11-21-16(20)13-9-5-6-10-14(13)17/h5-6,9-10,12H,2-4,7-8,11H2,1H3 |
| InChIKey | SQBDRWKYVSZFTM-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.24 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|