C17H24N2O6S — CID 7468062
[2-[cyclohexyl(methyl)amino]-2-oxoethyl] 2-methoxy-5-sulfamoylbenzoate (PubChem CID 7468062) has the molecular formula C17H24N2O6S and a molecular weight of 384.45 g/mol. Its IUPAC name is [2-[cyclohexyl(methyl)amino]-2-oxoethyl] 2-methoxy-5-sulfamoylbenzoate.
| Compound Name | [2-[cyclohexyl(methyl)amino]-2-oxoethyl] 2-methoxy-5-sulfamoylbenzoate |
|---|---|
| PubChem CID | 7468062 |
| Molecular Formula | C17H24N2O6S |
| Molecular Weight | 384.45 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | [2-[cyclohexyl(methyl)amino]-2-oxoethyl] 2-methoxy-5-sulfamoylbenzoate |
| SMILES | COc1ccc(S(N)(=O)=O)cc1C(=O)OCC(=O)N(C)C1CCCCC1 |
| InChI | InChI=1S/C17H24N2O6S/c1-19(12-6-4-3-5-7-12)16(20)11-25-17(21)14-10-13(26(18,22)23)8-9-15(14)24-2/h8-10,12H,3-7,11H2,1-2H3,(H2,18,22,23) |
| InChIKey | XNKVDQKNAWKZRB-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 116.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.45 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |