C16H22N2O7S — CID 16518493
[2-(2,6-dimethylmorpholin-4-yl)-2-oxoethyl] 2-methoxy-5-sulfamoylbenzoate (PubChem CID 16518493) has the molecular formula C16H22N2O7S and a molecular weight of 386.43 g/mol. Its IUPAC name is [2-(2,6-dimethylmorpholin-4-yl)-2-oxoethyl] 2-methoxy-5-sulfamoylbenzoate.
| Compound Name | [2-(2,6-dimethylmorpholin-4-yl)-2-oxoethyl] 2-methoxy-5-sulfamoylbenzoate |
|---|---|
| PubChem CID | 16518493 |
| Molecular Formula | C16H22N2O7S |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | [2-(2,6-dimethylmorpholin-4-yl)-2-oxoethyl] 2-methoxy-5-sulfamoylbenzoate |
| SMILES | COc1ccc(S(N)(=O)=O)cc1C(=O)OCC(=O)N1CC(C)OC(C)C1 |
| InChI | InChI=1S/C16H22N2O7S/c1-10-7-18(8-11(2)25-10)15(19)9-24-16(20)13-6-12(26(17,21)22)4-5-14(13)23-3/h4-6,10-11H,7-9H2,1-3H3,(H2,17,21,22) |
| InChIKey | YIMBDMOOFXUUHR-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 125.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |