C19H21NO7 — CID 2361326
[2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-2-oxoethyl] 8-methoxy-2-oxochromene-3-carboxylate (PubChem CID 2361326) has the molecular formula C19H21NO7 and a molecular weight of 375.38 g/mol. Its IUPAC name is [2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-2-oxoethyl] 8-methoxy-2-oxochromene-3-carboxylate.
| Compound Name | [2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-2-oxoethyl] 8-methoxy-2-oxochromene-3-carboxylate |
|---|---|
| PubChem CID | 2361326 |
| Molecular Formula | C19H21NO7 |
| Molecular Weight | 375.38 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | [2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-2-oxoethyl] 8-methoxy-2-oxochromene-3-carboxylate |
| SMILES | COc1cccc2cc(C(=O)OCC(=O)N3C[C@H](C)O[C@@H](C)C3)c(=O)oc12 |
| InChI | InChI=1S/C19H21NO7/c1-11-8-20(9-12(2)26-11)16(21)10-25-18(22)14-7-13-5-4-6-15(24-3)17(13)27-19(14)23/h4-7,11-12H,8-10H2,1-3H3/t11-,12-/m0/s1 |
| InChIKey | NIEJHOQJXMMZRT-RYUDHWBXSA-N |
| XLogP | 1.59 |
| TPSA | 95.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.38 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|