C22H21NO6 — CID 23937980
[2-oxo-2-(2,4,6-trimethylanilino)ethyl] 8-methoxy-2-oxochromene-3-carboxylate (PubChem CID 23937980) has the molecular formula C22H21NO6 and a molecular weight of 395.41 g/mol. Its IUPAC name is [2-oxo-2-(2,4,6-trimethylanilino)ethyl] 8-methoxy-2-oxochromene-3-carboxylate.
| Compound Name | [2-oxo-2-(2,4,6-trimethylanilino)ethyl] 8-methoxy-2-oxochromene-3-carboxylate |
|---|---|
| PubChem CID | 23937980 |
| Molecular Formula | C22H21NO6 |
| Molecular Weight | 395.41 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | [2-oxo-2-(2,4,6-trimethylanilino)ethyl] 8-methoxy-2-oxochromene-3-carboxylate |
| SMILES | COc1cccc2cc(C(=O)OCC(=O)Nc3c(C)cc(C)cc3C)c(=O)oc12 |
| InChI | InChI=1S/C22H21NO6/c1-12-8-13(2)19(14(3)9-12)23-18(24)11-28-21(25)16-10-15-6-5-7-17(27-4)20(15)29-22(16)26/h5-10H,11H2,1-4H3,(H,23,24) |
| InChIKey | IRCAXHPLUDXYJT-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.41 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|