C19H13FN2O8 — CID 23799883
[2-(2-fluoro-5-nitroanilino)-2-oxoethyl] 8-methoxy-2-oxochromene-3-carboxylate (PubChem CID 23799883) has the molecular formula C19H13FN2O8 and a molecular weight of 416.32 g/mol. Its IUPAC name is [2-(2-fluoro-5-nitroanilino)-2-oxoethyl] 8-methoxy-2-oxochromene-3-carboxylate.
| Compound Name | [2-(2-fluoro-5-nitroanilino)-2-oxoethyl] 8-methoxy-2-oxochromene-3-carboxylate |
|---|---|
| PubChem CID | 23799883 |
| Molecular Formula | C19H13FN2O8 |
| Molecular Weight | 416.32 g/mol |
| Exact Mass | 416.07 |
| IUPAC Name | [2-(2-fluoro-5-nitroanilino)-2-oxoethyl] 8-methoxy-2-oxochromene-3-carboxylate |
| SMILES | COc1cccc2cc(C(=O)OCC(=O)Nc3cc([N+](=O)[O-])ccc3F)c(=O)oc12 |
| InChI | InChI=1S/C19H13FN2O8/c1-28-15-4-2-3-10-7-12(19(25)30-17(10)15)18(24)29-9-16(23)21-14-8-11(22(26)27)5-6-13(14)20/h2-8H,9H2,1H3,(H,21,23) |
| InChIKey | ASXUQCQMYPCXLP-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 137.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.32 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|