C22H19NO8 — CID 23856868
[2-[(4-methoxycarbonylphenyl)methylamino]-2-oxoethyl] 8-methoxy-2-oxochromene-3-carboxylate (PubChem CID 23856868) has the molecular formula C22H19NO8 and a molecular weight of 425.39 g/mol. Its IUPAC name is [2-[(4-methoxycarbonylphenyl)methylamino]-2-oxoethyl] 8-methoxy-2-oxochromene-3-carboxylate.
| Compound Name | [2-[(4-methoxycarbonylphenyl)methylamino]-2-oxoethyl] 8-methoxy-2-oxochromene-3-carboxylate |
|---|---|
| PubChem CID | 23856868 |
| Molecular Formula | C22H19NO8 |
| Molecular Weight | 425.39 g/mol |
| Exact Mass | 425.11 |
| IUPAC Name | [2-[(4-methoxycarbonylphenyl)methylamino]-2-oxoethyl] 8-methoxy-2-oxochromene-3-carboxylate |
| SMILES | COC(=O)c1ccc(CNC(=O)COC(=O)c2cc3cccc(OC)c3oc2=O)cc1 |
| InChI | InChI=1S/C22H19NO8/c1-28-17-5-3-4-15-10-16(22(27)31-19(15)17)21(26)30-12-18(24)23-11-13-6-8-14(9-7-13)20(25)29-2/h3-10H,11-12H2,1-2H3,(H,23,24) |
| InChIKey | AQOHQFJQJVEWGY-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 121.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.39 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|