C24H25NO5 — CID 7043290
[2-[cyclohexyl(methyl)amino]-2-oxoethyl] 4-(2-oxo-2-phenylacetyl)benzoate (PubChem CID 7043290) has the molecular formula C24H25NO5 and a molecular weight of 407.47 g/mol. Its IUPAC name is [2-[cyclohexyl(methyl)amino]-2-oxoethyl] 4-(2-oxo-2-phenylacetyl)benzoate.
| Compound Name | [2-[cyclohexyl(methyl)amino]-2-oxoethyl] 4-(2-oxo-2-phenylacetyl)benzoate |
|---|---|
| PubChem CID | 7043290 |
| Molecular Formula | C24H25NO5 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | [2-[cyclohexyl(methyl)amino]-2-oxoethyl] 4-(2-oxo-2-phenylacetyl)benzoate |
| SMILES | CN(C(=O)COC(=O)c1ccc(C(=O)C(=O)c2ccccc2)cc1)C1CCCCC1 |
| InChI | InChI=1S/C24H25NO5/c1-25(20-10-6-3-7-11-20)21(26)16-30-24(29)19-14-12-18(13-15-19)23(28)22(27)17-8-4-2-5-9-17/h2,4-5,8-9,12-15,20H,3,6-7,10-11,16H2,1H3 |
| InChIKey | PMGOXSJBALSESY-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|