C16H20ClNO5S — CID 172580898
carbonothioic O,S-acid;[5-[[(Z)-prop-1-enyl]amino]oxolan-2-yl]methyl 3-chlorobenzoate (PubChem CID 172580898) has the molecular formula C16H20ClNO5S and a molecular weight of 373.86 g/mol. Its IUPAC name is carbonothioic O,S-acid;[5-[[(Z)-prop-1-enyl]amino]oxolan-2-yl]methyl 3-chlorobenzoate.
| Compound Name | carbonothioic O,S-acid;[5-[[(Z)-prop-1-enyl]amino]oxolan-2-yl]methyl 3-chlorobenzoate |
|---|---|
| PubChem CID | 172580898 |
| Molecular Formula | C16H20ClNO5S |
| Molecular Weight | 373.86 g/mol |
| Exact Mass | 373.08 |
| IUPAC Name | carbonothioic O,S-acid;[5-[[(Z)-prop-1-enyl]amino]oxolan-2-yl]methyl 3-chlorobenzoate |
| SMILES | C/C=C\NC1CCC(COC(=O)c2cccc(Cl)c2)O1.O=C(O)S |
| InChI | InChI=1S/C15H18ClNO3.CH2O2S/c1-2-8-17-14-7-6-13(20-14)10-19-15(18)11-4-3-5-12(16)9-11;2-1(3)4/h2-5,8-9,13-14,17H,6-7,10H2,1H3;4H,(H,2,3)/b8-2-; |
| InChIKey | RVTBXKLKINGSQC-WENINEFDSA-N |
| XLogP | 3.72 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.86 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|