C17H24O5 — CID 178006698
(5-acetyloxyoxolan-2-yl)methyl 4-methylbenzoate;ethane (PubChem CID 178006698) has the molecular formula C17H24O5 and a molecular weight of 308.37 g/mol. Its IUPAC name is (5-acetyloxyoxolan-2-yl)methyl 4-methylbenzoate;ethane.
| Compound Name | (5-acetyloxyoxolan-2-yl)methyl 4-methylbenzoate;ethane |
|---|---|
| PubChem CID | 178006698 |
| Molecular Formula | C17H24O5 |
| Molecular Weight | 308.37 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | (5-acetyloxyoxolan-2-yl)methyl 4-methylbenzoate;ethane |
| SMILES | CC.CC(=O)OC1CCC(COC(=O)c2ccc(C)cc2)O1 |
| InChI | InChI=1S/C15H18O5.C2H6/c1-10-3-5-12(6-4-10)15(17)18-9-13-7-8-14(20-13)19-11(2)16;1-2/h3-6,13-14H,7-9H2,1-2H3;1-2H3 |
| InChIKey | LPBNBUDMVMXXPP-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.37 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |