C31H30O9 — CID 11421436
[(2R,3R,4R)-5-acetyloxy-4-deuterio-3,4-bis[(4-methylbenzoyl)oxy]oxolan-2-yl]methyl 4-methylbenzoate (PubChem CID 11421436) has the molecular formula C31H30O9 and a molecular weight of 547.58 g/mol. Its IUPAC name is [(2R,3R,4R)-5-acetyloxy-4-deuterio-3,4-bis[(4-methylbenzoyl)oxy]oxolan-2-yl]methyl 4-methylbenzoate.
| Compound Name | [(2R,3R,4R)-5-acetyloxy-4-deuterio-3,4-bis[(4-methylbenzoyl)oxy]oxolan-2-yl]methyl 4-methylbenzoate |
|---|---|
| PubChem CID | 11421436 |
| Molecular Formula | C31H30O9 |
| Molecular Weight | 547.58 g/mol |
| Exact Mass | 547.20 |
| IUPAC Name | [(2R,3R,4R)-5-acetyloxy-4-deuterio-3,4-bis[(4-methylbenzoyl)oxy]oxolan-2-yl]methyl 4-methylbenzoate |
| SMILES | [2H][C@]1(OC(=O)c2ccc(C)cc2)C(OC(C)=O)O[C@H](COC(=O)c2ccc(C)cc2)[C@H]1OC(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C31H30O9/c1-18-5-11-22(12-6-18)28(33)36-17-25-26(39-29(34)23-13-7-19(2)8-14-23)27(31(38-25)37-21(4)32)40-30(35)24-15-9-20(3)10-16-24/h5-16,25-27,31H,17H2,1-4H3/t25-,26-,27-,31?/m1/s1/i27D |
| InChIKey | HDNMKBUSSAJGTD-ULDBENGMSA-N |
| XLogP | 4.51 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.58 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|