C16H18N6O4 — CID 137148885
[(2S,5R)-5-[(2-amino-5-diazenyl-6-oxo-1H-pyrimidin-4-yl)amino]oxolan-2-yl]methyl benzoate (PubChem CID 137148885) has the molecular formula C16H18N6O4 and a molecular weight of 358.36 g/mol. Its IUPAC name is [(2S,5R)-5-[(2-amino-5-diazenyl-6-oxo-1H-pyrimidin-4-yl)amino]oxolan-2-yl]methyl benzoate.
| Compound Name | [(2S,5R)-5-[(2-amino-5-diazenyl-6-oxo-1H-pyrimidin-4-yl)amino]oxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 137148885 |
| Molecular Formula | C16H18N6O4 |
| Molecular Weight | 358.36 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | [(2S,5R)-5-[(2-amino-5-diazenyl-6-oxo-1H-pyrimidin-4-yl)amino]oxolan-2-yl]methyl benzoate |
| SMILES | [H]/N=N/c1c(N[C@H]2CC[C@@H](COC(=O)c3ccccc3)O2)nc(N)[nH]c1=O |
| InChI | InChI=1S/C16H18N6O4/c17-16-20-13(12(22-18)14(23)21-16)19-11-7-6-10(26-11)8-25-15(24)9-4-2-1-3-5-9/h1-5,10-11,18H,6-8H2,(H4,17,19,20,21,23)/b22-18+/t10-,11+/m0/s1 |
| InChIKey | XDVDLZFRWXWESA-FKJCFNSASA-N |
| XLogP | 1.79 |
| TPSA | 155.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.36 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|