C17H17ClN4O3 — CID 167191364
[(2S)-5-[(5-chloro-4-methanimidoyl-1H-pyrazol-3-yl)amino]-3-methylideneoxolan-2-yl]methyl benzoate (PubChem CID 167191364) has the molecular formula C17H17ClN4O3 and a molecular weight of 360.80 g/mol. Its IUPAC name is [(2S)-5-[(5-chloro-4-methanimidoyl-1H-pyrazol-3-yl)amino]-3-methylideneoxolan-2-yl]methyl benzoate.
| Compound Name | [(2S)-5-[(5-chloro-4-methanimidoyl-1H-pyrazol-3-yl)amino]-3-methylideneoxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 167191364 |
| Molecular Formula | C17H17ClN4O3 |
| Molecular Weight | 360.80 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | [(2S)-5-[(5-chloro-4-methanimidoyl-1H-pyrazol-3-yl)amino]-3-methylideneoxolan-2-yl]methyl benzoate |
| SMILES | [H]/N=C/c1c(NC2CC(=C)[C@@H](COC(=O)c3ccccc3)O2)n[nH]c1Cl |
| InChI | InChI=1S/C17H17ClN4O3/c1-10-7-14(20-16-12(8-19)15(18)21-22-16)25-13(10)9-24-17(23)11-5-3-2-4-6-11/h2-6,8,13-14,19H,1,7,9H2,(H2,20,21,22)/b19-8+/t13-,14?/m1/s1 |
| InChIKey | JUYGDRRUPNYKOM-XDWFWCCZSA-N |
| XLogP | 3.00 |
| TPSA | 100.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.80 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|