C15H16O5 — CID 142701000
(4-ethynyl-4,5-dihydroxyoxolan-2-yl)methyl 4-methylbenzoate (PubChem CID 142701000) has the molecular formula C15H16O5 and a molecular weight of 276.29 g/mol. Its IUPAC name is (4-ethynyl-4,5-dihydroxyoxolan-2-yl)methyl 4-methylbenzoate.
| Compound Name | (4-ethynyl-4,5-dihydroxyoxolan-2-yl)methyl 4-methylbenzoate |
|---|---|
| PubChem CID | 142701000 |
| Molecular Formula | C15H16O5 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | (4-ethynyl-4,5-dihydroxyoxolan-2-yl)methyl 4-methylbenzoate |
| SMILES | C#CC1(O)CC(COC(=O)c2ccc(C)cc2)OC1O |
| InChI | InChI=1S/C15H16O5/c1-3-15(18)8-12(20-14(15)17)9-19-13(16)11-6-4-10(2)5-7-11/h1,4-7,12,14,17-18H,8-9H2,2H3 |
| InChIKey | ZHEQIKQUJBDQPD-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|