C17H19NO4 — CID 143157628
[(2S,5S)-5-[(E)-1-cyano-2-hydroxyethenyl]-4-methyloxolan-2-yl]methyl 4-methylbenzoate (PubChem CID 143157628) has the molecular formula C17H19NO4 and a molecular weight of 301.34 g/mol. Its IUPAC name is [(2S,5S)-5-[(E)-1-cyano-2-hydroxyethenyl]-4-methyloxolan-2-yl]methyl 4-methylbenzoate.
| Compound Name | [(2S,5S)-5-[(E)-1-cyano-2-hydroxyethenyl]-4-methyloxolan-2-yl]methyl 4-methylbenzoate |
|---|---|
| PubChem CID | 143157628 |
| Molecular Formula | C17H19NO4 |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | [(2S,5S)-5-[(E)-1-cyano-2-hydroxyethenyl]-4-methyloxolan-2-yl]methyl 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)OC[C@@H]2CC(C)[C@@H](/C(C#N)=C/O)O2)cc1 |
| InChI | InChI=1S/C17H19NO4/c1-11-3-5-13(6-4-11)17(20)21-10-15-7-12(2)16(22-15)14(8-18)9-19/h3-6,9,12,15-16,19H,7,10H2,1-2H3/b14-9+/t12?,15-,16-/m0/s1 |
| InChIKey | GAIMNFDNAAEBBN-RYEONGQGSA-N |
| XLogP | 2.91 |
| TPSA | 79.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|