C21H21ClO6 — CID 22856734
[(2R,3S,5R)-5-chloro-5-hydroxy-3-(4-methylbenzoyl)oxyoxolan-2-yl]methyl 4-methylbenzoate (PubChem CID 22856734) has the molecular formula C21H21ClO6 and a molecular weight of 404.85 g/mol. Its IUPAC name is [(2R,3S,5R)-5-chloro-5-hydroxy-3-(4-methylbenzoyl)oxyoxolan-2-yl]methyl 4-methylbenzoate.
| Compound Name | [(2R,3S,5R)-5-chloro-5-hydroxy-3-(4-methylbenzoyl)oxyoxolan-2-yl]methyl 4-methylbenzoate |
|---|---|
| PubChem CID | 22856734 |
| Molecular Formula | C21H21ClO6 |
| Molecular Weight | 404.85 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | [(2R,3S,5R)-5-chloro-5-hydroxy-3-(4-methylbenzoyl)oxyoxolan-2-yl]methyl 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)OC[C@H]2O[C@@](O)(Cl)C[C@@H]2OC(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C21H21ClO6/c1-13-3-7-15(8-4-13)19(23)26-12-18-17(11-21(22,25)28-18)27-20(24)16-9-5-14(2)6-10-16/h3-10,17-18,25H,11-12H2,1-2H3/t17-,18+,21+/m0/s1 |
| InChIKey | PXEUZFHXAIFXAN-WAOWUJCRSA-N |
| XLogP | 3.36 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.85 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|