C12H15NO5 — CID 170219609
[(2R,3S,4R)-3,4-dihydroxy-5-methyloxolan-2-yl]methyl pyridine-3-carboxylate (PubChem CID 170219609) has the molecular formula C12H15NO5 and a molecular weight of 253.25 g/mol. Its IUPAC name is [(2R,3S,4R)-3,4-dihydroxy-5-methyloxolan-2-yl]methyl pyridine-3-carboxylate.
| Compound Name | [(2R,3S,4R)-3,4-dihydroxy-5-methyloxolan-2-yl]methyl pyridine-3-carboxylate |
|---|---|
| PubChem CID | 170219609 |
| Molecular Formula | C12H15NO5 |
| Molecular Weight | 253.25 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | [(2R,3S,4R)-3,4-dihydroxy-5-methyloxolan-2-yl]methyl pyridine-3-carboxylate |
| SMILES | CC1O[C@H](COC(=O)c2cccnc2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C12H15NO5/c1-7-10(14)11(15)9(18-7)6-17-12(16)8-3-2-4-13-5-8/h2-5,7,9-11,14-15H,6H2,1H3/t7?,9-,10+,11-/m1/s1 |
| InChIKey | MUYKHEFLTYSDTG-XSRCVXOTSA-N |
| XLogP | -0.25 |
| TPSA | 88.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.25 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |