C16H18O7 — CID 11771621
[(3aR,4S,6R,6aS)-6-acetyloxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl] benzoate (PubChem CID 11771621) has the molecular formula C16H18O7 and a molecular weight of 322.31 g/mol. Its IUPAC name is [(3aR,4S,6R,6aS)-6-acetyloxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl] benzoate.
| Compound Name | [(3aR,4S,6R,6aS)-6-acetyloxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl] benzoate |
|---|---|
| PubChem CID | 11771621 |
| Molecular Formula | C16H18O7 |
| Molecular Weight | 322.31 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | [(3aR,4S,6R,6aS)-6-acetyloxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl] benzoate |
| SMILES | CC(=O)O[C@H]1O[C@@H](OC(=O)c2ccccc2)[C@@H]2OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C16H18O7/c1-9(17)19-14-11-12(23-16(2,3)22-11)15(21-14)20-13(18)10-7-5-4-6-8-10/h4-8,11-12,14-15H,1-3H3/t11-,12+,14-,15+/m0/s1 |
| InChIKey | LFAUNIDUCGTWBT-MYZSUADSSA-N |
| XLogP | 1.61 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.31 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |