C21H20O6Te — CID 122173482
[(3aR,4S,6S,6aS)-2,2-dimethyl-6-phenyltellanylcarbonyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl] benzoate (PubChem CID 122173482) has the molecular formula C21H20O6Te and a molecular weight of 495.99 g/mol. Its IUPAC name is [(3aR,4S,6S,6aS)-2,2-dimethyl-6-phenyltellanylcarbonyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl] benzoate.
| Compound Name | [(3aR,4S,6S,6aS)-2,2-dimethyl-6-phenyltellanylcarbonyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl] benzoate |
|---|---|
| PubChem CID | 122173482 |
| Molecular Formula | C21H20O6Te |
| Molecular Weight | 495.99 g/mol |
| Exact Mass | 498.03 |
| IUPAC Name | [(3aR,4S,6S,6aS)-2,2-dimethyl-6-phenyltellanylcarbonyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl] benzoate |
| SMILES | CC1(C)O[C@H]2[C@H](OC(=O)c3ccccc3)O[C@H](C(=O)[Te]c3ccccc3)[C@H]2O1 |
| InChI | InChI=1S/C21H20O6Te/c1-21(2)26-15-16(19(23)28-14-11-7-4-8-12-14)24-20(17(15)27-21)25-18(22)13-9-5-3-6-10-13/h3-12,15-17,20H,1-2H3/t15-,16+,17-,20+/m1/s1 |
| InChIKey | XJDJRZAGQMZHOJ-YZLZLFLDSA-N |
| XLogP | 1.64 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.99 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|