C10H13N3O3 — CID 174633921
2-[2-(pyridine-3-carbonyl)hydrazinyl]ethyl acetate (PubChem CID 174633921) has the molecular formula C10H13N3O3 and a molecular weight of 223.23 g/mol. Its IUPAC name is 2-[2-(pyridine-3-carbonyl)hydrazinyl]ethyl acetate.
| Compound Name | 2-[2-(pyridine-3-carbonyl)hydrazinyl]ethyl acetate |
|---|---|
| PubChem CID | 174633921 |
| Molecular Formula | C10H13N3O3 |
| Molecular Weight | 223.23 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | 2-[2-(pyridine-3-carbonyl)hydrazinyl]ethyl acetate |
| SMILES | CC(=O)OCCNNC(=O)c1cccnc1 |
| InChI | InChI=1S/C10H13N3O3/c1-8(14)16-6-5-12-13-10(15)9-3-2-4-11-7-9/h2-4,7,12H,5-6H2,1H3,(H,13,15) |
| InChIKey | KOQKMUBQGAGZIG-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.23 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|