C16H16ClN2O4- — CID 21236630
2-(pyridine-3-carbonylamino)ethyl 3-methoxybenzoate chloride (PubChem CID 21236630) has the molecular formula C16H16ClN2O4- and a molecular weight of 335.77 g/mol. Its IUPAC name is 2-(pyridine-3-carbonylamino)ethyl 3-methoxybenzoate chloride.
| Compound Name | 2-(pyridine-3-carbonylamino)ethyl 3-methoxybenzoate chloride |
|---|---|
| PubChem CID | 21236630 |
| Molecular Formula | C16H16ClN2O4- |
| Molecular Weight | 335.77 g/mol |
| Exact Mass | 335.08 |
| IUPAC Name | 2-(pyridine-3-carbonylamino)ethyl 3-methoxybenzoate chloride |
| SMILES | COc1cccc(C(=O)OCCNC(=O)c2cccnc2)c1.[Cl-] |
| InChI | InChI=1S/C16H16N2O4.ClH/c1-21-14-6-2-4-12(10-14)16(20)22-9-8-18-15(19)13-5-3-7-17-11-13;/h2-7,10-11H,8-9H2,1H3,(H,18,19);1H/p-1 |
| InChIKey | IRCBDSUHUMKZRO-UHFFFAOYSA-M |
| XLogP | -1.32 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.77 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|