C16H17ClN2O5 — CID 154774391
(3-methoxyphenyl) 2-(pyridine-3-carbonylamino)ethyl carbonate;hydrochloride (PubChem CID 154774391) has the molecular formula C16H17ClN2O5 and a molecular weight of 352.77 g/mol. Its IUPAC name is (3-methoxyphenyl) 2-(pyridine-3-carbonylamino)ethyl carbonate;hydrochloride.
| Compound Name | (3-methoxyphenyl) 2-(pyridine-3-carbonylamino)ethyl carbonate;hydrochloride |
|---|---|
| PubChem CID | 154774391 |
| Molecular Formula | C16H17ClN2O5 |
| Molecular Weight | 352.77 g/mol |
| Exact Mass | 352.08 |
| IUPAC Name | (3-methoxyphenyl) 2-(pyridine-3-carbonylamino)ethyl carbonate;hydrochloride |
| SMILES | COc1cccc(OC(=O)OCCNC(=O)c2cccnc2)c1.Cl |
| InChI | InChI=1S/C16H16N2O5.ClH/c1-21-13-5-2-6-14(10-13)23-16(20)22-9-8-18-15(19)12-4-3-7-17-11-12;/h2-7,10-11H,8-9H2,1H3,(H,18,19);1H |
| InChIKey | FBTXKBJRNOYQQY-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 86.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.77 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|