C16H16N4O3 — CID 32688575
N-[[4-[(pyridine-3-carbonylamino)carbamoyl]phenyl]methyl]acetamide (PubChem CID 32688575) has the molecular formula C16H16N4O3 and a molecular weight of 312.33 g/mol. Its IUPAC name is N-[[4-[(pyridine-3-carbonylamino)carbamoyl]phenyl]methyl]acetamide.
| Compound Name | N-[[4-[(pyridine-3-carbonylamino)carbamoyl]phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 32688575 |
| Molecular Formula | C16H16N4O3 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | N-[[4-[(pyridine-3-carbonylamino)carbamoyl]phenyl]methyl]acetamide |
| SMILES | CC(=O)NCc1ccc(C(=O)NNC(=O)c2cccnc2)cc1 |
| InChI | InChI=1S/C16H16N4O3/c1-11(21)18-9-12-4-6-13(7-5-12)15(22)19-20-16(23)14-3-2-8-17-10-14/h2-8,10H,9H2,1H3,(H,18,21)(H,19,22)(H,20,23) |
| InChIKey | ONFALJKZGPVBNT-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|