C21H18ClN3O5 — CID 70624116
[4-(acetamidomethyl)-2-(pyridine-3-carbonyloxy)phenyl] pyridine-3-carboxylate;hydrochloride (PubChem CID 70624116) has the molecular formula C21H18ClN3O5 and a molecular weight of 427.84 g/mol. Its IUPAC name is [4-(acetamidomethyl)-2-(pyridine-3-carbonyloxy)phenyl] pyridine-3-carboxylate;hydrochloride.
| Compound Name | [4-(acetamidomethyl)-2-(pyridine-3-carbonyloxy)phenyl] pyridine-3-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 70624116 |
| Molecular Formula | C21H18ClN3O5 |
| Molecular Weight | 427.84 g/mol |
| Exact Mass | 427.09 |
| IUPAC Name | [4-(acetamidomethyl)-2-(pyridine-3-carbonyloxy)phenyl] pyridine-3-carboxylate;hydrochloride |
| SMILES | CC(=O)NCc1ccc(OC(=O)c2cccnc2)c(OC(=O)c2cccnc2)c1.Cl |
| InChI | InChI=1S/C21H17N3O5.ClH/c1-14(25)24-11-15-6-7-18(28-20(26)16-4-2-8-22-12-16)19(10-15)29-21(27)17-5-3-9-23-13-17;/h2-10,12-13H,11H2,1H3,(H,24,25);1H |
| InChIKey | YIJKBGCSWJSVIV-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 107.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.84 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|