C22H21N3O4 — CID 19794551
[4-[2-(ethylamino)ethyl]-2-(pyridine-3-carbonyloxy)phenyl] pyridine-3-carboxylate (PubChem CID 19794551) has the molecular formula C22H21N3O4 and a molecular weight of 391.43 g/mol. Its IUPAC name is [4-[2-(ethylamino)ethyl]-2-(pyridine-3-carbonyloxy)phenyl] pyridine-3-carboxylate.
| Compound Name | [4-[2-(ethylamino)ethyl]-2-(pyridine-3-carbonyloxy)phenyl] pyridine-3-carboxylate |
|---|---|
| PubChem CID | 19794551 |
| Molecular Formula | C22H21N3O4 |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | [4-[2-(ethylamino)ethyl]-2-(pyridine-3-carbonyloxy)phenyl] pyridine-3-carboxylate |
| SMILES | CCNCCc1ccc(OC(=O)c2cccnc2)c(OC(=O)c2cccnc2)c1 |
| InChI | InChI=1S/C22H21N3O4/c1-2-23-12-9-16-7-8-19(28-21(26)17-5-3-10-24-14-17)20(13-16)29-22(27)18-6-4-11-25-15-18/h3-8,10-11,13-15,23H,2,9,12H2,1H3 |
| InChIKey | JZNBQPOCMVEHPA-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|