C11H15N3O5S — CID 141388144
[1-amino-3-(pyridine-3-carbonylsulfamoyl)propan-2-yl] acetate (PubChem CID 141388144) has the molecular formula C11H15N3O5S and a molecular weight of 301.32 g/mol. Its IUPAC name is [1-amino-3-(pyridine-3-carbonylsulfamoyl)propan-2-yl] acetate.
| Compound Name | [1-amino-3-(pyridine-3-carbonylsulfamoyl)propan-2-yl] acetate |
|---|---|
| PubChem CID | 141388144 |
| Molecular Formula | C11H15N3O5S |
| Molecular Weight | 301.32 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | [1-amino-3-(pyridine-3-carbonylsulfamoyl)propan-2-yl] acetate |
| SMILES | CC(=O)OC(CN)CS(=O)(=O)NC(=O)c1cccnc1 |
| InChI | InChI=1S/C11H15N3O5S/c1-8(15)19-10(5-12)7-20(17,18)14-11(16)9-3-2-4-13-6-9/h2-4,6,10H,5,7,12H2,1H3,(H,14,16) |
| InChIKey | IJQKCUKJDLLJEO-UHFFFAOYSA-N |
| XLogP | -0.97 |
| TPSA | 128.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.32 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |