C9H12ClN3O3S — CID 141388137
N-(3-amino-2-chloropropyl)sulfonylpyridine-3-carboxamide (PubChem CID 141388137) has the molecular formula C9H12ClN3O3S and a molecular weight of 277.73 g/mol. Its IUPAC name is N-(3-amino-2-chloropropyl)sulfonylpyridine-3-carboxamide.
| Compound Name | N-(3-amino-2-chloropropyl)sulfonylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 141388137 |
| Molecular Formula | C9H12ClN3O3S |
| Molecular Weight | 277.73 g/mol |
| Exact Mass | 277.03 |
| IUPAC Name | N-(3-amino-2-chloropropyl)sulfonylpyridine-3-carboxamide |
| SMILES | NCC(Cl)CS(=O)(=O)NC(=O)c1cccnc1 |
| InChI | InChI=1S/C9H12ClN3O3S/c10-8(4-11)6-17(15,16)13-9(14)7-2-1-3-12-5-7/h1-3,5,8H,4,6,11H2,(H,13,14) |
| InChIKey | KFTHAQSMWQABHB-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.73 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|