C16H19N3O4 — CID 155927926
N'-[(2,3,4-trimethoxyphenyl)methyl]pyridine-3-carbohydrazide (PubChem CID 155927926) has the molecular formula C16H19N3O4 and a molecular weight of 317.35 g/mol. Its IUPAC name is N'-[(2,3,4-trimethoxyphenyl)methyl]pyridine-3-carbohydrazide.
| Compound Name | N'-[(2,3,4-trimethoxyphenyl)methyl]pyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 155927926 |
| Molecular Formula | C16H19N3O4 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | N'-[(2,3,4-trimethoxyphenyl)methyl]pyridine-3-carbohydrazide |
| SMILES | COc1ccc(CNNC(=O)c2cccnc2)c(OC)c1OC |
| InChI | InChI=1S/C16H19N3O4/c1-21-13-7-6-11(14(22-2)15(13)23-3)10-18-19-16(20)12-5-4-8-17-9-12/h4-9,18H,10H2,1-3H3,(H,19,20) |
| InChIKey | YHNQWOQFDLDEQD-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 81.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|