C20H19N3O3 — CID 53149720
N-[(2,3-dimethoxyphenyl)methyl]-6-pyridin-3-ylpyridine-3-carboxamide (PubChem CID 53149720) has the molecular formula C20H19N3O3 and a molecular weight of 349.39 g/mol. Its IUPAC name is N-[(2,3-dimethoxyphenyl)methyl]-6-pyridin-3-ylpyridine-3-carboxamide.
| Compound Name | N-[(2,3-dimethoxyphenyl)methyl]-6-pyridin-3-ylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 53149720 |
| Molecular Formula | C20H19N3O3 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | N-[(2,3-dimethoxyphenyl)methyl]-6-pyridin-3-ylpyridine-3-carboxamide |
| SMILES | COc1cccc(CNC(=O)c2ccc(-c3cccnc3)nc2)c1OC |
| InChI | InChI=1S/C20H19N3O3/c1-25-18-7-3-5-15(19(18)26-2)12-23-20(24)16-8-9-17(22-13-16)14-6-4-10-21-11-14/h3-11,13H,12H2,1-2H3,(H,23,24) |
| InChIKey | HTMNJDHDFKNARJ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |