C18H14ClN3O — CID 71841638
N-[(4-chlorophenyl)methyl]-6-pyridin-3-ylpyridine-3-carboxamide (PubChem CID 71841638) has the molecular formula C18H14ClN3O and a molecular weight of 323.78 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-6-pyridin-3-ylpyridine-3-carboxamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-6-pyridin-3-ylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 71841638 |
| Molecular Formula | C18H14ClN3O |
| Molecular Weight | 323.78 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-6-pyridin-3-ylpyridine-3-carboxamide |
| SMILES | O=C(NCc1ccc(Cl)cc1)c1ccc(-c2cccnc2)nc1 |
| InChI | InChI=1S/C18H14ClN3O/c19-16-6-3-13(4-7-16)10-22-18(23)15-5-8-17(21-12-15)14-2-1-9-20-11-14/h1-9,11-12H,10H2,(H,22,23) |
| InChIKey | VNROUQYGCNFSRF-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.78 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |