C17H12ClFN4O — CID 71841602
N-[(3-chloro-4-fluorophenyl)methyl]-6-pyrimidin-5-ylpyridine-3-carboxamide (PubChem CID 71841602) has the molecular formula C17H12ClFN4O and a molecular weight of 342.76 g/mol. Its IUPAC name is N-[(3-chloro-4-fluorophenyl)methyl]-6-pyrimidin-5-ylpyridine-3-carboxamide.
| Compound Name | N-[(3-chloro-4-fluorophenyl)methyl]-6-pyrimidin-5-ylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 71841602 |
| Molecular Formula | C17H12ClFN4O |
| Molecular Weight | 342.76 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | N-[(3-chloro-4-fluorophenyl)methyl]-6-pyrimidin-5-ylpyridine-3-carboxamide |
| SMILES | O=C(NCc1ccc(F)c(Cl)c1)c1ccc(-c2cncnc2)nc1 |
| InChI | InChI=1S/C17H12ClFN4O/c18-14-5-11(1-3-15(14)19)6-23-17(24)12-2-4-16(22-9-12)13-7-20-10-21-8-13/h1-5,7-10H,6H2,(H,23,24) |
| InChIKey | UXTXODKJBAALKW-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.76 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |