C15H20N4O4 — CID 50906669
ethyl 2,2-dimethyl-1-[(pyridine-3-carbonylamino)carbamoylamino]cyclopropane-1-carboxylate (PubChem CID 50906669) has the molecular formula C15H20N4O4 and a molecular weight of 320.35 g/mol. Its IUPAC name is ethyl 2,2-dimethyl-1-[(pyridine-3-carbonylamino)carbamoylamino]cyclopropane-1-carboxylate.
| Compound Name | ethyl 2,2-dimethyl-1-[(pyridine-3-carbonylamino)carbamoylamino]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 50906669 |
| Molecular Formula | C15H20N4O4 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | ethyl 2,2-dimethyl-1-[(pyridine-3-carbonylamino)carbamoylamino]cyclopropane-1-carboxylate |
| SMILES | CCOC(=O)C1(NC(=O)NNC(=O)c2cccnc2)CC1(C)C |
| InChI | InChI=1S/C15H20N4O4/c1-4-23-12(21)15(9-14(15,2)3)17-13(22)19-18-11(20)10-6-5-7-16-8-10/h5-8H,4,9H2,1-3H3,(H,18,20)(H2,17,19,22) |
| InChIKey | HHDRRDYBUZZKPX-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 109.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|