C10H12N4O2 — CID 23300028
1-prop-2-enyl-3-(pyridine-3-carbonylamino)urea (PubChem CID 23300028) has the molecular formula C10H12N4O2 and a molecular weight of 220.23 g/mol. Its IUPAC name is 1-prop-2-enyl-3-(pyridine-3-carbonylamino)urea.
| Compound Name | 1-prop-2-enyl-3-(pyridine-3-carbonylamino)urea |
|---|---|
| PubChem CID | 23300028 |
| Molecular Formula | C10H12N4O2 |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | 1-prop-2-enyl-3-(pyridine-3-carbonylamino)urea |
| SMILES | C=CCNC(=O)NNC(=O)c1cccnc1 |
| InChI | InChI=1S/C10H12N4O2/c1-2-5-12-10(16)14-13-9(15)8-4-3-6-11-7-8/h2-4,6-7H,1,5H2,(H,13,15)(H2,12,14,16) |
| InChIKey | LFUSREYVWZFHME-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|