C30H36O11 — CID 66968973
[(2R,3R,4S,5R)-3,4,5-triacetyloxy-6-[3-[(4-ethylphenyl)methyl]-5-hydroxy-4-methylphenyl]-6-hydroxyoxan-2-yl]methyl acetate (PubChem CID 66968973) has the molecular formula C30H36O11 and a molecular weight of 572.61 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-3,4,5-triacetyloxy-6-[3-[(4-ethylphenyl)methyl]-5-hydroxy-4-methylphenyl]-6-hydroxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R)-3,4,5-triacetyloxy-6-[3-[(4-ethylphenyl)methyl]-5-hydroxy-4-methylphenyl]-6-hydroxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 66968973 |
| Molecular Formula | C30H36O11 |
| Molecular Weight | 572.61 g/mol |
| Exact Mass | 572.23 |
| IUPAC Name | [(2R,3R,4S,5R)-3,4,5-triacetyloxy-6-[3-[(4-ethylphenyl)methyl]-5-hydroxy-4-methylphenyl]-6-hydroxyoxan-2-yl]methyl acetate |
| SMILES | CCc1ccc(Cc2cc(C3(O)O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]3OC(C)=O)cc(O)c2C)cc1 |
| InChI | InChI=1S/C30H36O11/c1-7-21-8-10-22(11-9-21)12-23-13-24(14-25(35)16(23)2)30(36)29(40-20(6)34)28(39-19(5)33)27(38-18(4)32)26(41-30)15-37-17(3)31/h8-11,13-14,26-29,35-36H,7,12,15H2,1-6H3/t26-,27-,28+,29-,30?/m1/s1 |
| InChIKey | URNGNKSVPYPGQQ-MPUKMYDRSA-N |
| XLogP | 2.76 |
| TPSA | 154.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.61 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|