C18H26N2O9 — CID 54293749
N-butyl-2-[(2R,3S,4S,5R,6S)-3,5-dihydroxy-2-(hydroxymethyl)-6-(4-nitrophenoxy)oxan-4-yl]oxyacetamide (PubChem CID 54293749) has the molecular formula C18H26N2O9 and a molecular weight of 414.41 g/mol. Its IUPAC name is N-butyl-2-[(2R,3S,4S,5R,6S)-3,5-dihydroxy-2-(hydroxymethyl)-6-(4-nitrophenoxy)oxan-4-yl]oxyacetamide.
| Compound Name | N-butyl-2-[(2R,3S,4S,5R,6S)-3,5-dihydroxy-2-(hydroxymethyl)-6-(4-nitrophenoxy)oxan-4-yl]oxyacetamide |
|---|---|
| PubChem CID | 54293749 |
| Molecular Formula | C18H26N2O9 |
| Molecular Weight | 414.41 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | N-butyl-2-[(2R,3S,4S,5R,6S)-3,5-dihydroxy-2-(hydroxymethyl)-6-(4-nitrophenoxy)oxan-4-yl]oxyacetamide |
| SMILES | CCCCNC(=O)CO[C@H]1[C@@H](O)[C@@H](CO)O[C@@H](Oc2ccc([N+](=O)[O-])cc2)[C@@H]1O |
| InChI | InChI=1S/C18H26N2O9/c1-2-3-8-19-14(22)10-27-17-15(23)13(9-21)29-18(16(17)24)28-12-6-4-11(5-7-12)20(25)26/h4-7,13,15-18,21,23-24H,2-3,8-10H2,1H3,(H,19,22)/t13-,15+,16-,17+,18-/m1/s1 |
| InChIKey | RZIHJLKBUUVHLB-QRIFCXAISA-N |
| XLogP | -0.29 |
| TPSA | 160.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.41 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|