C18H26N2O8 — CID 3945578
N-[4,5-dihydroxy-6-(hydroxymethyl)-2-(4-nitrophenoxy)oxan-3-yl]hexanamide (PubChem CID 3945578) has the molecular formula C18H26N2O8 and a molecular weight of 398.41 g/mol. Its IUPAC name is N-[4,5-dihydroxy-6-(hydroxymethyl)-2-(4-nitrophenoxy)oxan-3-yl]hexanamide.
| Compound Name | N-[4,5-dihydroxy-6-(hydroxymethyl)-2-(4-nitrophenoxy)oxan-3-yl]hexanamide |
|---|---|
| PubChem CID | 3945578 |
| Molecular Formula | C18H26N2O8 |
| Molecular Weight | 398.41 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | N-[4,5-dihydroxy-6-(hydroxymethyl)-2-(4-nitrophenoxy)oxan-3-yl]hexanamide |
| SMILES | CCCCCC(=O)NC1C(Oc2ccc([N+](=O)[O-])cc2)OC(CO)C(O)C1O |
| InChI | InChI=1S/C18H26N2O8/c1-2-3-4-5-14(22)19-15-17(24)16(23)13(10-21)28-18(15)27-12-8-6-11(7-9-12)20(25)26/h6-9,13,15-18,21,23-24H,2-5,10H2,1H3,(H,19,22) |
| InChIKey | GWFUHHWMBNYGNM-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 151.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.41 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|