C12H15N5O7 — CID 164771376
(3R,4R,5S,6R)-6-(hydroxymethyl)-3-[(7-nitro-2H-benzotriazol-4-yl)amino]oxane-2,4,5-triol (PubChem CID 164771376) has the molecular formula C12H15N5O7 and a molecular weight of 341.28 g/mol. Its IUPAC name is (3R,4R,5S,6R)-6-(hydroxymethyl)-3-[(7-nitro-2H-benzotriazol-4-yl)amino]oxane-2,4,5-triol.
| Compound Name | (3R,4R,5S,6R)-6-(hydroxymethyl)-3-[(7-nitro-2H-benzotriazol-4-yl)amino]oxane-2,4,5-triol |
|---|---|
| PubChem CID | 164771376 |
| Molecular Formula | C12H15N5O7 |
| Molecular Weight | 341.28 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | (3R,4R,5S,6R)-6-(hydroxymethyl)-3-[(7-nitro-2H-benzotriazol-4-yl)amino]oxane-2,4,5-triol |
| SMILES | O=[N+]([O-])c1ccc(N[C@H]2C(O)O[C@H](CO)[C@@H](O)[C@@H]2O)c2n[nH]nc12 |
| InChI | InChI=1S/C12H15N5O7/c18-3-6-10(19)11(20)9(12(21)24-6)13-4-1-2-5(17(22)23)8-7(4)14-16-15-8/h1-2,6,9-13,18-21H,3H2,(H,14,15,16)/t6-,9-,10-,11-,12?/m1/s1 |
| InChIKey | XNGOSRGBKGHPDO-BGCUHRRXSA-N |
| XLogP | -1.92 |
| TPSA | 186.89 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.28 |
| LogP ≤ 5 | -1.92 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|